About 2-methoxypropylthiourea
2-methoxypropylthiourea (PubChem CID 102697400) has the molecular formula C5H12N2OS
and a molecular weight of 148.23 g/mol. Its IUPAC name is 2-methoxypropylthiourea.
Molecular Properties
| Compound Name | 2-methoxypropylthiourea |
| PubChem CID | 102697400 |
| Molecular Formula | C5H12N2OS |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-methoxypropylthiourea |
| SMILES | COC(C)CNC(N)=S |
| InChI | InChI=1S/C5H12N2OS/c1-4(8-2)3-7-5(6)9/h4H,3H2,1-2H3,(H3,6,7,9) |
| InChIKey | ISTJVTFBZXBWCU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxypropylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypropylthiourea?
The IUPAC name of 2-methoxypropylthiourea (CID 102697400) is 2-methoxypropylthiourea.
What is the SMILES notation for 2-methoxypropylthiourea?
The canonical SMILES for 2-methoxypropylthiourea is COC(C)CNC(N)=S.
What is the InChIKey of 2-methoxypropylthiourea?
The InChIKey is ISTJVTFBZXBWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2OS/c1-4(8-2)3-7-5(6)9/h4H,3H2,1-2H3,(H3,6,7,9).
What are the key properties of 2-methoxypropylthiourea?
2-methoxypropylthiourea has a molecular weight of 148.23 g/mol, XLogP of -0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypropylthiourea is sourced from PubChem (CID 102697400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).