About 2,2-diaminoethylthiourea
2,2-diaminoethylthiourea (PubChem CID 141082129) has the molecular formula C3H10N4S
and a molecular weight of 134.21 g/mol. Its IUPAC name is 2,2-diaminoethylthiourea.
Molecular Properties
| Compound Name | 2,2-diaminoethylthiourea |
| PubChem CID | 141082129 |
| Molecular Formula | C3H10N4S |
| Molecular Weight | 134.21 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 2,2-diaminoethylthiourea |
| SMILES | NC(=S)NCC(N)N |
| InChI | InChI=1S/C3H10N4S/c4-2(5)1-7-3(6)8/h2H,1,4-5H2,(H3,6,7,8) |
| InChIKey | HUBSMPVGZKVEFM-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.21 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diaminoethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diaminoethylthiourea?
The IUPAC name of 2,2-diaminoethylthiourea (CID 141082129) is 2,2-diaminoethylthiourea.
What is the SMILES notation for 2,2-diaminoethylthiourea?
The canonical SMILES for 2,2-diaminoethylthiourea is NC(=S)NCC(N)N.
What is the InChIKey of 2,2-diaminoethylthiourea?
The InChIKey is HUBSMPVGZKVEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N4S/c4-2(5)1-7-3(6)8/h2H,1,4-5H2,(H3,6,7,8).
What are the key properties of 2,2-diaminoethylthiourea?
2,2-diaminoethylthiourea has a molecular weight of 134.21 g/mol, XLogP of -1.94, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diaminoethylthiourea is sourced from PubChem (CID 141082129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).