C3H10N4S — CID 141082129
2,2-diaminoethylthiourea (PubChem CID 141082129) has the molecular formula C3H10N4S and a molecular weight of 134.21 g/mol. Its IUPAC name is 2,2-diaminoethylthiourea.
| Compound Name | 2,2-diaminoethylthiourea |
|---|---|
| PubChem CID | 141082129 |
| Molecular Formula | C3H10N4S |
| Molecular Weight | 134.21 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 2,2-diaminoethylthiourea |
| SMILES | NC(=S)NCC(N)N |
| InChI | InChI=1S/C3H10N4S/c4-2(5)1-7-3(6)8/h2H,1,4-5H2,(H3,6,7,8) |
| InChIKey | HUBSMPVGZKVEFM-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.21 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|