C14H19ClN2O3S — CID 102699463
2-(1-chloroethyl)-1-(2-methoxypropyl)-4-methylsulfonylbenzimidazole (PubChem CID 102699463) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(2-methoxypropyl)-4-methylsulfonylbenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(2-methoxypropyl)-4-methylsulfonylbenzimidazole |
|---|---|
| PubChem CID | 102699463 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-(1-chloroethyl)-1-(2-methoxypropyl)-4-methylsulfonylbenzimidazole |
| SMILES | COC(C)Cn1c(C(C)Cl)nc2c(S(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-9(20-3)8-17-11-6-5-7-12(21(4,18)19)13(11)16-14(17)10(2)15/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | SEABQDFGOHYHQV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|