C19H32N4O3 — CID 10270164
(3R)-3-[3-[(cyclobutylamino)methyl]-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide (PubChem CID 10270164) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3R)-3-[3-[(cyclobutylamino)methyl]-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide.
| Compound Name | (3R)-3-[3-[(cyclobutylamino)methyl]-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 10270164 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (3R)-3-[3-[(cyclobutylamino)methyl]-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide |
| SMILES | O=C(C[C@@H](CCCC1CCCCC1)c1nc(CNC2CCC2)no1)NO |
| InChI | InChI=1S/C19H32N4O3/c24-18(22-25)12-15(9-4-8-14-6-2-1-3-7-14)19-21-17(23-26-19)13-20-16-10-5-11-16/h14-16,20,25H,1-13H2,(H,22,24)/t15-/m1/s1 |
| InChIKey | STXXGOLFIDISGZ-OAHLLOKOSA-N |
| XLogP | 3.44 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|