C8H20N4O2 — CID 102702168
1-amino-3-(2-methoxyethyl)-2-(2-methoxypropyl)guanidine (PubChem CID 102702168) has the molecular formula C8H20N4O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-amino-3-(2-methoxyethyl)-2-(2-methoxypropyl)guanidine.
| Compound Name | 1-amino-3-(2-methoxyethyl)-2-(2-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 102702168 |
| Molecular Formula | C8H20N4O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-amino-3-(2-methoxyethyl)-2-(2-methoxypropyl)guanidine |
| SMILES | COCCN/C(=N\CC(C)OC)NN |
| InChI | InChI=1S/C8H20N4O2/c1-7(14-3)6-11-8(12-9)10-4-5-13-2/h7H,4-6,9H2,1-3H3,(H2,10,11,12) |
| InChIKey | DUZTUNHJZNDJKB-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|