C10H21F3N4O2 — CID 104886393
1-amino-2-(3-ethoxypropyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine (PubChem CID 104886393) has the molecular formula C10H21F3N4O2 and a molecular weight of 286.30 g/mol. Its IUPAC name is 1-amino-2-(3-ethoxypropyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine.
| Compound Name | 1-amino-2-(3-ethoxypropyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 104886393 |
| Molecular Formula | C10H21F3N4O2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 1-amino-2-(3-ethoxypropyl)-3-[2-(2,2,2-trifluoroethoxy)ethyl]guanidine |
| SMILES | CCOCCC/N=C(\NN)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H21F3N4O2/c1-2-18-6-3-4-15-9(17-14)16-5-7-19-8-10(11,12)13/h2-8,14H2,1H3,(H2,15,16,17) |
| InChIKey | PURAUQIYGRHSHC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|