C7H15F3N4O — CID 104883039
1-amino-3-(1-methoxypropan-2-yl)-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 104883039) has the molecular formula C7H15F3N4O and a molecular weight of 228.22 g/mol. Its IUPAC name is 1-amino-3-(1-methoxypropan-2-yl)-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-amino-3-(1-methoxypropan-2-yl)-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 104883039 |
| Molecular Formula | C7H15F3N4O |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-amino-3-(1-methoxypropan-2-yl)-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | COCC(C)N/C(=N/CC(F)(F)F)NN |
| InChI | InChI=1S/C7H15F3N4O/c1-5(3-15-2)13-6(14-11)12-4-7(8,9)10/h5H,3-4,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | VOTQDFHGOBSQOP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|