C11H10N6O2 — CID 102703041
4-methoxy-2-(tetrazolo[1,5-a]pyrazin-5-yloxy)aniline (PubChem CID 102703041) has the molecular formula C11H10N6O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is 4-methoxy-2-(tetrazolo[1,5-a]pyrazin-5-yloxy)aniline.
| Compound Name | 4-methoxy-2-(tetrazolo[1,5-a]pyrazin-5-yloxy)aniline |
|---|---|
| PubChem CID | 102703041 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-methoxy-2-(tetrazolo[1,5-a]pyrazin-5-yloxy)aniline |
| SMILES | COc1ccc(N)c(Oc2cncc3nnnn23)c1 |
| InChI | InChI=1S/C11H10N6O2/c1-18-7-2-3-8(12)9(4-7)19-11-6-13-5-10-14-15-16-17(10)11/h2-6H,12H2,1H3 |
| InChIKey | LBHMUYPVEORQGO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|