C12H11N5O3 — CID 141350603
4-(4-hydroxypyrazolo[4,3-d]pyrimidin-3-yl)oxy-2-methoxyaniline (PubChem CID 141350603) has the molecular formula C12H11N5O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is 4-(4-hydroxypyrazolo[4,3-d]pyrimidin-3-yl)oxy-2-methoxyaniline.
| Compound Name | 4-(4-hydroxypyrazolo[4,3-d]pyrimidin-3-yl)oxy-2-methoxyaniline |
|---|---|
| PubChem CID | 141350603 |
| Molecular Formula | C12H11N5O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-(4-hydroxypyrazolo[4,3-d]pyrimidin-3-yl)oxy-2-methoxyaniline |
| SMILES | COc1cc(Oc2nnc3cncn(O)c2-3)ccc1N |
| InChI | InChI=1S/C12H11N5O3/c1-19-10-4-7(2-3-8(10)13)20-12-11-9(15-16-12)5-14-6-17(11)18/h2-6,18H,13H2,1H3 |
| InChIKey | JMSHTXXXZRONRD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|