C17H31N3O — CID 102706847
5-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2,4-dimethylcyclohexane-1-carboxamide (PubChem CID 102706847) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 5-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2,4-dimethylcyclohexane-1-carboxamide.
| Compound Name | 5-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2,4-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 102706847 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 5-amino-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2,4-dimethylcyclohexane-1-carboxamide |
| SMILES | CC1CC(C)C(C(=O)NC2CCN3CCCC3C2)CC1N |
| InChI | InChI=1S/C17H31N3O/c1-11-8-12(2)16(18)10-15(11)17(21)19-13-5-7-20-6-3-4-14(20)9-13/h11-16H,3-10,18H2,1-2H3,(H,19,21) |
| InChIKey | PAZNUJLDEKBMMS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |