C19H20Cl2N4 — CID 10270806
7-(cyclopropylmethyl)-2-(2,4-dichlorophenyl)-10-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene (PubChem CID 10270806) has the molecular formula C19H20Cl2N4 and a molecular weight of 375.30 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-2-(2,4-dichlorophenyl)-10-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene.
| Compound Name | 7-(cyclopropylmethyl)-2-(2,4-dichlorophenyl)-10-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene |
|---|---|
| PubChem CID | 10270806 |
| Molecular Formula | C19H20Cl2N4 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 7-(cyclopropylmethyl)-2-(2,4-dichlorophenyl)-10-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene |
| SMILES | Cc1nc2c3c(n1)N(c1ccc(Cl)cc1Cl)CC3CCN2CC1CC1 |
| InChI | InChI=1S/C19H20Cl2N4/c1-11-22-18-17-13(6-7-24(18)9-12-2-3-12)10-25(19(17)23-11)16-5-4-14(20)8-15(16)21/h4-5,8,12-13H,2-3,6-7,9-10H2,1H3 |
| InChIKey | YALBAQFFCQQJKN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |