C14H19F3N2 — CID 102708268
(3-ethylcyclopentyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 102708268) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (3-ethylcyclopentyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | (3-ethylcyclopentyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 102708268 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (3-ethylcyclopentyl)-[4-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | CCC1CCC(C(N)c2cnccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H19F3N2/c1-2-9-3-4-10(7-9)13(18)11-8-19-6-5-12(11)14(15,16)17/h5-6,8-10,13H,2-4,7,18H2,1H3 |
| InChIKey | SOUSQVXRBGGYDK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |