C10H13Cl2F3N2 — CID 131637722
cyclopropyl-[3-(trifluoromethyl)-4-pyridinyl]methanamine;dihydrochloride (PubChem CID 131637722) has the molecular formula C10H13Cl2F3N2 and a molecular weight of 289.13 g/mol. Its IUPAC name is cyclopropyl-[3-(trifluoromethyl)-4-pyridinyl]methanamine;dihydrochloride.
| Compound Name | cyclopropyl-[3-(trifluoromethyl)-4-pyridinyl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 131637722 |
| Molecular Formula | C10H13Cl2F3N2 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | cyclopropyl-[3-(trifluoromethyl)-4-pyridinyl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NC(c1ccncc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H11F3N2.2ClH/c11-10(12,13)8-5-15-4-3-7(8)9(14)6-1-2-6;;/h3-6,9H,1-2,14H2;2*1H |
| InChIKey | SXDSWYIDEQRWMJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |