C10H12ClF3N2 — CID 131637723
cyclopropyl-[3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride (PubChem CID 131637723) has the molecular formula C10H12ClF3N2 and a molecular weight of 252.67 g/mol. Its IUPAC name is cyclopropyl-[3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride.
| Compound Name | cyclopropyl-[3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 131637723 |
| Molecular Formula | C10H12ClF3N2 |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | cyclopropyl-[3-(trifluoromethyl)-2-pyridinyl]methanamine;hydrochloride |
| SMILES | Cl.NC(c1ncccc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H11F3N2.ClH/c11-10(12,13)7-2-1-5-15-9(7)8(14)6-3-4-6;/h1-2,5-6,8H,3-4,14H2;1H |
| InChIKey | ZVJHLXQVYWLQLB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |