C14H19F3N2O — CID 102708423
N-methyl-1-(2-methyloxan-2-yl)-1-[4-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 102708423) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is N-methyl-1-(2-methyloxan-2-yl)-1-[4-(trifluoromethyl)-3-pyridinyl]methanamine.
| Compound Name | N-methyl-1-(2-methyloxan-2-yl)-1-[4-(trifluoromethyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 102708423 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-methyl-1-(2-methyloxan-2-yl)-1-[4-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | CNC(c1cnccc1C(F)(F)F)C1(C)CCCCO1 |
| InChI | InChI=1S/C14H19F3N2O/c1-13(6-3-4-8-20-13)12(18-2)10-9-19-7-5-11(10)14(15,16)17/h5,7,9,12,18H,3-4,6,8H2,1-2H3 |
| InChIKey | CNWSKMXVHFSRFL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |