C13H7Cl2F3N2O — CID 102709472
(4-amino-3,5-dichlorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 102709472) has the molecular formula C13H7Cl2F3N2O and a molecular weight of 335.11 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 102709472 |
| Molecular Formula | C13H7Cl2F3N2O |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-[4-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Nc1c(Cl)cc(C(=O)c2cnccc2C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H7Cl2F3N2O/c14-9-3-6(4-10(15)11(9)19)12(21)7-5-20-2-1-8(7)13(16,17)18/h1-5H,19H2 |
| InChIKey | MRTZESVUXIPZGC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|