C16H10Cl2N2O — CID 116609827
(4-amino-3,5-dichlorophenyl)-isoquinolin-4-ylmethanone (PubChem CID 116609827) has the molecular formula C16H10Cl2N2O and a molecular weight of 317.18 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-isoquinolin-4-ylmethanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-isoquinolin-4-ylmethanone |
|---|---|
| PubChem CID | 116609827 |
| Molecular Formula | C16H10Cl2N2O |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-isoquinolin-4-ylmethanone |
| SMILES | Nc1c(Cl)cc(C(=O)c2cncc3ccccc23)cc1Cl |
| InChI | InChI=1S/C16H10Cl2N2O/c17-13-5-10(6-14(18)15(13)19)16(21)12-8-20-7-9-3-1-2-4-11(9)12/h1-8H,19H2 |
| InChIKey | NVKJIQIRFRXNSS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|