C14H14N4O2 — CID 102711618
1-(2-oxo-1,3-dihydroindole-6-carbonyl)piperazine-2-carbonitrile (PubChem CID 102711618) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 1-(2-oxo-1,3-dihydroindole-6-carbonyl)piperazine-2-carbonitrile.
| Compound Name | 1-(2-oxo-1,3-dihydroindole-6-carbonyl)piperazine-2-carbonitrile |
|---|---|
| PubChem CID | 102711618 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-(2-oxo-1,3-dihydroindole-6-carbonyl)piperazine-2-carbonitrile |
| SMILES | N#CC1CNCCN1C(=O)c1ccc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C14H14N4O2/c15-7-11-8-16-3-4-18(11)14(20)10-2-1-9-6-13(19)17-12(9)5-10/h1-2,5,11,16H,3-4,6,8H2,(H,17,19) |
| InChIKey | WCSZYVWFQWMEFV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |