C15H17N3O3 — CID 102714226
3-methyl-8-nitro-N-(oxolan-2-ylmethyl)isoquinolin-5-amine (PubChem CID 102714226) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-methyl-8-nitro-N-(oxolan-2-ylmethyl)isoquinolin-5-amine.
| Compound Name | 3-methyl-8-nitro-N-(oxolan-2-ylmethyl)isoquinolin-5-amine |
|---|---|
| PubChem CID | 102714226 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-methyl-8-nitro-N-(oxolan-2-ylmethyl)isoquinolin-5-amine |
| SMILES | Cc1cc2c(NCC3CCCO3)ccc([N+](=O)[O-])c2cn1 |
| InChI | InChI=1S/C15H17N3O3/c1-10-7-12-13(9-16-10)15(18(19)20)5-4-14(12)17-8-11-3-2-6-21-11/h4-5,7,9,11,17H,2-3,6,8H2,1H3 |
| InChIKey | GPUOYDXZCXKKMS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|