C14H16N4O4 — CID 7123560
4-(5-methyl-1,3,4-oxadiazol-2-yl)-2-nitro-N-[[(2S)-oxolan-2-yl]methyl]aniline (PubChem CID 7123560) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 4-(5-methyl-1,3,4-oxadiazol-2-yl)-2-nitro-N-[[(2S)-oxolan-2-yl]methyl]aniline.
| Compound Name | 4-(5-methyl-1,3,4-oxadiazol-2-yl)-2-nitro-N-[[(2S)-oxolan-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 7123560 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-(5-methyl-1,3,4-oxadiazol-2-yl)-2-nitro-N-[[(2S)-oxolan-2-yl]methyl]aniline |
| SMILES | Cc1nnc(-c2ccc(NC[C@@H]3CCCO3)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C14H16N4O4/c1-9-16-17-14(22-9)10-4-5-12(13(7-10)18(19)20)15-8-11-3-2-6-21-11/h4-5,7,11,15H,2-3,6,8H2,1H3/t11-/m0/s1 |
| InChIKey | RNYKFFYPKWJVKO-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|