C18H17N5O4 — CID 41168819
2-nitro-N-[[(2R)-oxolan-2-yl]methyl]-4-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)aniline (PubChem CID 41168819) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is 2-nitro-N-[[(2R)-oxolan-2-yl]methyl]-4-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)aniline.
| Compound Name | 2-nitro-N-[[(2R)-oxolan-2-yl]methyl]-4-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)aniline |
|---|---|
| PubChem CID | 41168819 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-nitro-N-[[(2R)-oxolan-2-yl]methyl]-4-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)aniline |
| SMILES | O=[N+]([O-])c1cc(-c2noc(-c3ccccn3)n2)ccc1NC[C@H]1CCCO1 |
| InChI | InChI=1S/C18H17N5O4/c24-23(25)16-10-12(6-7-14(16)20-11-13-4-3-9-26-13)17-21-18(27-22-17)15-5-1-2-8-19-15/h1-2,5-8,10,13,20H,3-4,9,11H2/t13-/m1/s1 |
| InChIKey | NQUYPAMSSJLPRS-CYBMUJFWSA-N |
| XLogP | 3.30 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|