C15H16BrF3O2 — CID 102714629
2-[[3-bromo-4-(trifluoromethoxy)phenoxy]methyl]bicyclo[2.2.1]heptane (PubChem CID 102714629) has the molecular formula C15H16BrF3O2 and a molecular weight of 365.19 g/mol. Its IUPAC name is 2-[[3-bromo-4-(trifluoromethoxy)phenoxy]methyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[[3-bromo-4-(trifluoromethoxy)phenoxy]methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 102714629 |
| Molecular Formula | C15H16BrF3O2 |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-[[3-bromo-4-(trifluoromethoxy)phenoxy]methyl]bicyclo[2.2.1]heptane |
| SMILES | FC(F)(F)Oc1ccc(OCC2CC3CCC2C3)cc1Br |
| InChI | InChI=1S/C15H16BrF3O2/c16-13-7-12(3-4-14(13)21-15(17,18)19)20-8-11-6-9-1-2-10(11)5-9/h3-4,7,9-11H,1-2,5-6,8H2 |
| InChIKey | HDRVHOVICUIRIF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |