C26H24N2O2 — CID 10272079
benzyl 1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxylate (PubChem CID 10272079) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is benzyl 1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxylate.
| Compound Name | benzyl 1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxylate |
|---|---|
| PubChem CID | 10272079 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | benzyl 1-methyl-4,5-bis(4-methylphenyl)imidazole-2-carboxylate |
| SMILES | Cc1ccc(-c2nc(C(=O)OCc3ccccc3)n(C)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-18-9-13-21(14-10-18)23-24(22-15-11-19(2)12-16-22)28(3)25(27-23)26(29)30-17-20-7-5-4-6-8-20/h4-16H,17H2,1-3H3 |
| InChIKey | SIEQHBLPHYILHG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |