C11H11F6NO2 — CID 102721653
2-ethoxy-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)aniline (PubChem CID 102721653) has the molecular formula C11H11F6NO2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 2-ethoxy-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)aniline.
| Compound Name | 2-ethoxy-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)aniline |
|---|---|
| PubChem CID | 102721653 |
| Molecular Formula | C11H11F6NO2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-ethoxy-4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)aniline |
| SMILES | CCOc1cc(OC(C(F)(F)F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C11H11F6NO2/c1-2-19-8-5-6(3-4-7(8)18)20-9(10(12,13)14)11(15,16)17/h3-5,9H,2,18H2,1H3 |
| InChIKey | WEEVNRMZDLKBMN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|