C12H13F6NO2 — CID 102721621
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5-propoxyaniline (PubChem CID 102721621) has the molecular formula C12H13F6NO2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5-propoxyaniline.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5-propoxyaniline |
|---|---|
| PubChem CID | 102721621 |
| Molecular Formula | C12H13F6NO2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5-propoxyaniline |
| SMILES | CCCOc1cc(N)cc(OC(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F6NO2/c1-2-3-20-8-4-7(19)5-9(6-8)21-10(11(13,14)15)12(16,17)18/h4-6,10H,2-3,19H2,1H3 |
| InChIKey | NJSNELTVJRIOKF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|