C13H21F6NO — CID 102721859
N-ethyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3,5-dimethylcyclohexan-1-amine (PubChem CID 102721859) has the molecular formula C13H21F6NO and a molecular weight of 321.31 g/mol. Its IUPAC name is N-ethyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3,5-dimethylcyclohexan-1-amine.
| Compound Name | N-ethyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102721859 |
| Molecular Formula | C13H21F6NO |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-ethyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3,5-dimethylcyclohexan-1-amine |
| SMILES | CCNC1CC(C)CC(C)C1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H21F6NO/c1-4-20-9-6-7(2)5-8(3)10(9)21-11(12(14,15)16)13(17,18)19/h7-11,20H,4-6H2,1-3H3 |
| InChIKey | IWZMSUDDDWQNRA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |