C11H17F6NO — CID 102721871
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N,4-dimethylcyclohexan-1-amine (PubChem CID 102721871) has the molecular formula C11H17F6NO and a molecular weight of 293.25 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N,4-dimethylcyclohexan-1-amine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102721871 |
| Molecular Formula | C11H17F6NO |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N,4-dimethylcyclohexan-1-amine |
| SMILES | CNC1CCC(C)CC1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H17F6NO/c1-6-3-4-7(18-2)8(5-6)19-9(10(12,13)14)11(15,16)17/h6-9,18H,3-5H2,1-2H3 |
| InChIKey | AREGRVAMJOPELZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |