C9H11F6NO — CID 102722363
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 102722363) has the molecular formula C9H11F6NO and a molecular weight of 263.18 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 102722363 |
| Molecular Formula | C9H11F6NO |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | FC(F)(F)C(OCC1=CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F6NO/c10-8(11,12)7(9(13,14)15)17-5-6-1-3-16-4-2-6/h1,7,16H,2-5H2 |
| InChIKey | IBBNXIJOXCZONF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|