C8H13F2NO — CID 114404638
4-(2,2-difluoroethoxymethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 114404638) has the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxymethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(2,2-difluoroethoxymethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 114404638 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 4-(2,2-difluoroethoxymethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | FC(F)COCC1=CCNCC1 |
| InChI | InChI=1S/C8H13F2NO/c9-8(10)6-12-5-7-1-3-11-4-2-7/h1,8,11H,2-6H2 |
| InChIKey | POINOIMNNQARMM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|