C11H8BrClF6O — CID 102722925
1-[2-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-2-chlorobenzene (PubChem CID 102722925) has the molecular formula C11H8BrClF6O and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[2-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-2-chlorobenzene.
| Compound Name | 1-[2-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-2-chlorobenzene |
|---|---|
| PubChem CID | 102722925 |
| Molecular Formula | C11H8BrClF6O |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 1-[2-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-2-chlorobenzene |
| SMILES | FC(F)(F)C(OC(CBr)c1ccccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C11H8BrClF6O/c12-5-8(6-3-1-2-4-7(6)13)20-9(10(14,15)16)11(17,18)19/h1-4,8-9H,5H2 |
| InChIKey | TXKOGUVBUMLJKA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|