C10H12F6N4O — CID 102723712
[6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 102723712) has the molecular formula C10H12F6N4O and a molecular weight of 318.22 g/mol. Its IUPAC name is [6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 102723712 |
| Molecular Formula | C10H12F6N4O |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | CC(C)c1nc(NN)cc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H12F6N4O/c1-4(2)7-18-5(20-17)3-6(19-7)21-8(9(11,12)13)10(14,15)16/h3-4,8H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | RIVYCYDHIPFSQG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|