C23H18N2O3S — CID 10272461
6-benzyl-2-(1-hydroxy-3-phenylprop-2-ynyl)-8-methyl-[1,3]thiazolo[3,2-c]pyrimidine-5,7-dione (PubChem CID 10272461) has the molecular formula C23H18N2O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 6-benzyl-2-(1-hydroxy-3-phenylprop-2-ynyl)-8-methyl-[1,3]thiazolo[3,2-c]pyrimidine-5,7-dione.
| Compound Name | 6-benzyl-2-(1-hydroxy-3-phenylprop-2-ynyl)-8-methyl-[1,3]thiazolo[3,2-c]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 10272461 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 6-benzyl-2-(1-hydroxy-3-phenylprop-2-ynyl)-8-methyl-[1,3]thiazolo[3,2-c]pyrimidine-5,7-dione |
| SMILES | Cc1c(=O)n(Cc2ccccc2)c(=O)n2cc(C(O)C#Cc3ccccc3)sc12 |
| InChI | InChI=1S/C23H18N2O3S/c1-16-21(27)24(14-18-10-6-3-7-11-18)23(28)25-15-20(29-22(16)25)19(26)13-12-17-8-4-2-5-9-17/h2-11,15,19,26H,14H2,1H3 |
| InChIKey | ATSYPIKXGZKZOO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|