C12H22N2O2 — CID 102725793
2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-aminopropanoic acid (PubChem CID 102725793) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-aminopropanoic acid.
| Compound Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-aminopropanoic acid |
|---|---|
| PubChem CID | 102725793 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-aminopropanoic acid |
| SMILES | NCC(C(=O)O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C12H22N2O2/c13-8-11(12(15)16)14-7-3-5-9-4-1-2-6-10(9)14/h9-11H,1-8,13H2,(H,15,16)/t9-,10-,11?/m1/s1 |
| InChIKey | ZZLMTMHVFBXHJT-DIOIDXFWSA-N |
| XLogP | 1.05 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |