C13H26N2 — CID 102726031
3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]butan-2-amine (PubChem CID 102726031) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]butan-2-amine.
| Compound Name | 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]butan-2-amine |
|---|---|
| PubChem CID | 102726031 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]butan-2-amine |
| SMILES | CC(N)C(C)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H26N2/c1-10(14)11(2)15-9-5-7-12-6-3-4-8-13(12)15/h10-13H,3-9,14H2,1-2H3/t10?,11?,12-,13-/m1/s1 |
| InChIKey | ZLDPJDSOLATPMV-FIYWTHMPSA-N |
| XLogP | 2.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |