C12H23NO — CID 65320344
3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)butan-2-ol (PubChem CID 65320344) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)butan-2-ol.
| Compound Name | 3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 65320344 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)butan-2-ol |
| SMILES | CC(O)C(C)N1CCCC2CCCC21 |
| InChI | InChI=1S/C12H23NO/c1-9(10(2)14)13-8-4-6-11-5-3-7-12(11)13/h9-12,14H,3-8H2,1-2H3 |
| InChIKey | PAVLPINFGOUYEE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |