C14H22ClN3O2S — CID 102728988
(4aR,8aR)-1-[[4-(chloromethyl)-5-methyl-1H-pyrazol-3-yl]sulfonyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 102728988) has the molecular formula C14H22ClN3O2S and a molecular weight of 331.87 g/mol. Its IUPAC name is (4aR,8aR)-1-[[4-(chloromethyl)-5-methyl-1H-pyrazol-3-yl]sulfonyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aR,8aR)-1-[[4-(chloromethyl)-5-methyl-1H-pyrazol-3-yl]sulfonyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 102728988 |
| Molecular Formula | C14H22ClN3O2S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (4aR,8aR)-1-[[4-(chloromethyl)-5-methyl-1H-pyrazol-3-yl]sulfonyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | Cc1[nH]nc(S(=O)(=O)N2CCC[C@H]3CCCC[C@H]32)c1CCl |
| InChI | InChI=1S/C14H22ClN3O2S/c1-10-12(9-15)14(17-16-10)21(19,20)18-8-4-6-11-5-2-3-7-13(11)18/h11,13H,2-9H2,1H3,(H,16,17)/t11-,13-/m1/s1 |
| InChIKey | FTYHZXRHXQYGPC-DGCLKSJQSA-N |
| XLogP | 2.80 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|