C13H23N5O2S — CID 79919948
[3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-5-methyl-1H-pyrazol-4-yl]methanamine (PubChem CID 79919948) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is [3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-5-methyl-1H-pyrazol-4-yl]methanamine.
| Compound Name | [3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-5-methyl-1H-pyrazol-4-yl]methanamine |
|---|---|
| PubChem CID | 79919948 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | [3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-5-methyl-1H-pyrazol-4-yl]methanamine |
| SMILES | Cc1[nH]nc(S(=O)(=O)N2CCN3CCCCC3C2)c1CN |
| InChI | InChI=1S/C13H23N5O2S/c1-10-12(8-14)13(16-15-10)21(19,20)18-7-6-17-5-3-2-4-11(17)9-18/h11H,2-9,14H2,1H3,(H,15,16) |
| InChIKey | WFAAWGFZQNPNBE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |