C11H20N4O2S — CID 106026981
4-(aminomethyl)-N-(cyclopentylmethyl)-5-methyl-1H-pyrazole-3-sulfonamide (PubChem CID 106026981) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(cyclopentylmethyl)-5-methyl-1H-pyrazole-3-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(cyclopentylmethyl)-5-methyl-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106026981 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-(aminomethyl)-N-(cyclopentylmethyl)-5-methyl-1H-pyrazole-3-sulfonamide |
| SMILES | Cc1[nH]nc(S(=O)(=O)NCC2CCCC2)c1CN |
| InChI | InChI=1S/C11H20N4O2S/c1-8-10(6-12)11(15-14-8)18(16,17)13-7-9-4-2-3-5-9/h9,13H,2-7,12H2,1H3,(H,14,15) |
| InChIKey | OQFOLMOLXDPCBC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |