C14H28N4O2S — CID 107818690
4-(aminomethyl)-5-methyl-N-(7-methyloctyl)-1H-pyrazole-3-sulfonamide (PubChem CID 107818690) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 4-(aminomethyl)-5-methyl-N-(7-methyloctyl)-1H-pyrazole-3-sulfonamide.
| Compound Name | 4-(aminomethyl)-5-methyl-N-(7-methyloctyl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 107818690 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 4-(aminomethyl)-5-methyl-N-(7-methyloctyl)-1H-pyrazole-3-sulfonamide |
| SMILES | Cc1[nH]nc(S(=O)(=O)NCCCCCCC(C)C)c1CN |
| InChI | InChI=1S/C14H28N4O2S/c1-11(2)8-6-4-5-7-9-16-21(19,20)14-13(10-15)12(3)17-18-14/h11,16H,4-10,15H2,1-3H3,(H,17,18) |
| InChIKey | HRLUTYGUIVLJTI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|