C10H14N6O2S — CID 106089524
4-(aminomethyl)-5-methyl-N-(pyridazin-3-ylmethyl)-1H-pyrazole-3-sulfonamide (PubChem CID 106089524) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 4-(aminomethyl)-5-methyl-N-(pyridazin-3-ylmethyl)-1H-pyrazole-3-sulfonamide.
| Compound Name | 4-(aminomethyl)-5-methyl-N-(pyridazin-3-ylmethyl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106089524 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(aminomethyl)-5-methyl-N-(pyridazin-3-ylmethyl)-1H-pyrazole-3-sulfonamide |
| SMILES | Cc1[nH]nc(S(=O)(=O)NCc2cccnn2)c1CN |
| InChI | InChI=1S/C10H14N6O2S/c1-7-9(5-11)10(16-14-7)19(17,18)13-6-8-3-2-4-12-15-8/h2-4,13H,5-6,11H2,1H3,(H,14,16) |
| InChIKey | YEKYNFSIARPUAI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |