C12H14ClFN4O2S — CID 106055543
4-(aminomethyl)-N-[(3-chloro-4-fluorophenyl)methyl]-5-methyl-1H-pyrazole-3-sulfonamide (PubChem CID 106055543) has the molecular formula C12H14ClFN4O2S and a molecular weight of 332.79 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(3-chloro-4-fluorophenyl)methyl]-5-methyl-1H-pyrazole-3-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-[(3-chloro-4-fluorophenyl)methyl]-5-methyl-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106055543 |
| Molecular Formula | C12H14ClFN4O2S |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-(aminomethyl)-N-[(3-chloro-4-fluorophenyl)methyl]-5-methyl-1H-pyrazole-3-sulfonamide |
| SMILES | Cc1[nH]nc(S(=O)(=O)NCc2ccc(F)c(Cl)c2)c1CN |
| InChI | InChI=1S/C12H14ClFN4O2S/c1-7-9(5-15)12(18-17-7)21(19,20)16-6-8-2-3-11(14)10(13)4-8/h2-4,16H,5-6,15H2,1H3,(H,17,18) |
| InChIKey | SOFZCMIBENXJDB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |