C11H13BrN4O2S — CID 106061259
4-(aminomethyl)-N-(2-bromophenyl)-5-methyl-1H-pyrazole-3-sulfonamide (PubChem CID 106061259) has the molecular formula C11H13BrN4O2S and a molecular weight of 345.22 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-bromophenyl)-5-methyl-1H-pyrazole-3-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(2-bromophenyl)-5-methyl-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106061259 |
| Molecular Formula | C11H13BrN4O2S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 4-(aminomethyl)-N-(2-bromophenyl)-5-methyl-1H-pyrazole-3-sulfonamide |
| SMILES | Cc1[nH]nc(S(=O)(=O)Nc2ccccc2Br)c1CN |
| InChI | InChI=1S/C11H13BrN4O2S/c1-7-8(6-13)11(15-14-7)19(17,18)16-10-5-3-2-4-9(10)12/h2-5,16H,6,13H2,1H3,(H,14,15) |
| InChIKey | BUTLBSCVXSHIAT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |