C12H22N4O2S2 — CID 106078547
5-methyl-4-(methylaminomethyl)-N-(thian-4-ylmethyl)-1H-pyrazole-3-sulfonamide (PubChem CID 106078547) has the molecular formula C12H22N4O2S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 5-methyl-4-(methylaminomethyl)-N-(thian-4-ylmethyl)-1H-pyrazole-3-sulfonamide.
| Compound Name | 5-methyl-4-(methylaminomethyl)-N-(thian-4-ylmethyl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106078547 |
| Molecular Formula | C12H22N4O2S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-methyl-4-(methylaminomethyl)-N-(thian-4-ylmethyl)-1H-pyrazole-3-sulfonamide |
| SMILES | CNCc1c(S(=O)(=O)NCC2CCSCC2)n[nH]c1C |
| InChI | InChI=1S/C12H22N4O2S2/c1-9-11(8-13-2)12(16-15-9)20(17,18)14-7-10-3-5-19-6-4-10/h10,13-14H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | HMYFNJJLQQXGNW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |