C13H24N4O3S — CID 106062981
4-(ethylaminomethyl)-5-methyl-N-(oxan-4-ylmethyl)-1H-pyrazole-3-sulfonamide (PubChem CID 106062981) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-5-methyl-N-(oxan-4-ylmethyl)-1H-pyrazole-3-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-5-methyl-N-(oxan-4-ylmethyl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106062981 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-(ethylaminomethyl)-5-methyl-N-(oxan-4-ylmethyl)-1H-pyrazole-3-sulfonamide |
| SMILES | CCNCc1c(S(=O)(=O)NCC2CCOCC2)n[nH]c1C |
| InChI | InChI=1S/C13H24N4O3S/c1-3-14-9-12-10(2)16-17-13(12)21(18,19)15-8-11-4-6-20-7-5-11/h11,14-15H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | HPFVEYQLVCZQSB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |