C13H26N4O2S — CID 106028545
4-(ethylaminomethyl)-5-methyl-N-(4-methylpentan-2-yl)-1H-pyrazole-3-sulfonamide (PubChem CID 106028545) has the molecular formula C13H26N4O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-5-methyl-N-(4-methylpentan-2-yl)-1H-pyrazole-3-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-5-methyl-N-(4-methylpentan-2-yl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106028545 |
| Molecular Formula | C13H26N4O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-(ethylaminomethyl)-5-methyl-N-(4-methylpentan-2-yl)-1H-pyrazole-3-sulfonamide |
| SMILES | CCNCc1c(S(=O)(=O)NC(C)CC(C)C)n[nH]c1C |
| InChI | InChI=1S/C13H26N4O2S/c1-6-14-8-12-11(5)15-16-13(12)20(18,19)17-10(4)7-9(2)3/h9-10,14,17H,6-8H2,1-5H3,(H,15,16) |
| InChIKey | VNNHZZLAEUMKAW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |