C10H20N4O2S2 — CID 114142069
5-methyl-4-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)-1H-pyrazole-3-sulfonamide (PubChem CID 114142069) has the molecular formula C10H20N4O2S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 5-methyl-4-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)-1H-pyrazole-3-sulfonamide.
| Compound Name | 5-methyl-4-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 114142069 |
| Molecular Formula | C10H20N4O2S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-methyl-4-(methylaminomethyl)-N-(1-methylsulfanylpropan-2-yl)-1H-pyrazole-3-sulfonamide |
| SMILES | CNCc1c(S(=O)(=O)NC(C)CSC)n[nH]c1C |
| InChI | InChI=1S/C10H20N4O2S2/c1-7(6-17-4)14-18(15,16)10-9(5-11-3)8(2)12-13-10/h7,11,14H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | CGJUURVATLJEDJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |