C12H20N6O2S — CID 106083463
N-[1-(1H-imidazol-2-yl)propyl]-5-methyl-4-(methylaminomethyl)-1H-pyrazole-3-sulfonamide (PubChem CID 106083463) has the molecular formula C12H20N6O2S and a molecular weight of 312.40 g/mol. Its IUPAC name is N-[1-(1H-imidazol-2-yl)propyl]-5-methyl-4-(methylaminomethyl)-1H-pyrazole-3-sulfonamide.
| Compound Name | N-[1-(1H-imidazol-2-yl)propyl]-5-methyl-4-(methylaminomethyl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 106083463 |
| Molecular Formula | C12H20N6O2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[1-(1H-imidazol-2-yl)propyl]-5-methyl-4-(methylaminomethyl)-1H-pyrazole-3-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1n[nH]c(C)c1CNC)c1ncc[nH]1 |
| InChI | InChI=1S/C12H20N6O2S/c1-4-10(11-14-5-6-15-11)18-21(19,20)12-9(7-13-3)8(2)16-17-12/h5-6,10,13,18H,4,7H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | CWAFBBFAQQCNBL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |