C26H40N12O2 — CID 162195808
1,3-bis[1-(1H-imidazol-2-yl)propyl]urea (PubChem CID 162195808) has the molecular formula C26H40N12O2 and a molecular weight of 552.69 g/mol. Its IUPAC name is 1,3-bis[1-(1H-imidazol-2-yl)propyl]urea.
| Compound Name | 1,3-bis[1-(1H-imidazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 162195808 |
| Molecular Formula | C26H40N12O2 |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | 1,3-bis[1-(1H-imidazol-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)NC(CC)c1ncc[nH]1)c1ncc[nH]1.CCC(NC(=O)NC(CC)c1ncc[nH]1)c1ncc[nH]1 |
| InChI | InChI=1S/2C13H20N6O/c2*1-3-9(11-14-5-6-15-11)18-13(20)19-10(4-2)12-16-7-8-17-12/h2*5-10H,3-4H2,1-2H3,(H,14,15)(H,16,17)(H2,18,19,20) |
| InChIKey | ZQXOAVMCLZIZOC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 196.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |