C11H22N6 — CID 116516466
1-amino-2-butyl-3-[1-(1H-imidazol-2-yl)propyl]guanidine (PubChem CID 116516466) has the molecular formula C11H22N6 and a molecular weight of 238.34 g/mol. Its IUPAC name is 1-amino-2-butyl-3-[1-(1H-imidazol-2-yl)propyl]guanidine.
| Compound Name | 1-amino-2-butyl-3-[1-(1H-imidazol-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 116516466 |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-amino-2-butyl-3-[1-(1H-imidazol-2-yl)propyl]guanidine |
| SMILES | CCCC/N=C(\NN)NC(CC)c1ncc[nH]1 |
| InChI | InChI=1S/C11H22N6/c1-3-5-6-15-11(17-12)16-9(4-2)10-13-7-8-14-10/h7-9H,3-6,12H2,1-2H3,(H,13,14)(H2,15,16,17) |
| InChIKey | WCTDQRRPGVWIPU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|