C7H14N6 — CID 116511019
1-amino-3-[1-(1H-imidazol-2-yl)ethyl]-2-methylguanidine (PubChem CID 116511019) has the molecular formula C7H14N6 and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-amino-3-[1-(1H-imidazol-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-amino-3-[1-(1H-imidazol-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 116511019 |
| Molecular Formula | C7H14N6 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-amino-3-[1-(1H-imidazol-2-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NN)NC(C)c1ncc[nH]1 |
| InChI | InChI=1S/C7H14N6/c1-5(6-10-3-4-11-6)12-7(9-2)13-8/h3-5H,8H2,1-2H3,(H,10,11)(H2,9,12,13) |
| InChIKey | OXRLTVRZHVQDAJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|